C18H18ClNO2 — CID 11186141
(3R,4S,5R)-2-benzyl-3-(4-chlorophenyl)-5-methyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 11186141) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (3R,4S,5R)-2-benzyl-3-(4-chlorophenyl)-5-methyl-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | (3R,4S,5R)-2-benzyl-3-(4-chlorophenyl)-5-methyl-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 11186141 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (3R,4S,5R)-2-benzyl-3-(4-chlorophenyl)-5-methyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | C[C@H]1ON(Cc2ccccc2)[C@@H](c2ccc(Cl)cc2)[C@@H]1C=O |
| InChI | InChI=1S/C18H18ClNO2/c1-13-17(12-21)18(15-7-9-16(19)10-8-15)20(22-13)11-14-5-3-2-4-6-14/h2-10,12-13,17-18H,11H2,1H3/t13-,17-,18+/m1/s1 |
| InChIKey | CUJBAIKZVZGTMU-XWIAVFTESA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|