C24H31FN4O3 — CID 111861430
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111861430) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111861430 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H31FN4O3/c1-2-26-24(28-20-8-9-22-23(16-20)32-13-3-12-31-22)27-17-21(29-10-14-30-15-11-29)18-4-6-19(25)7-5-18/h4-9,16,21H,2-3,10-15,17H2,1H3,(H2,26,27,28) |
| InChIKey | YSROMAUULLABTH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|