C21H25F2N5OS — CID 111861613
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(4-propan-2-yloxyphenyl)-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111861613) has the molecular formula C21H25F2N5OS and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(4-propan-2-yloxyphenyl)-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(4-propan-2-yloxyphenyl)-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111861613 |
| Molecular Formula | C21H25F2N5OS |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(4-propan-2-yloxyphenyl)-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(=N/Cc2nccn2C(F)F)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C21H25F2N5OS/c1-15(2)29-17-7-5-16(6-8-17)27-21(25-10-9-18-4-3-13-30-18)26-14-19-24-11-12-28(19)20(22)23/h3-8,11-13,15,20H,9-10,14H2,1-2H3,(H2,25,26,27) |
| InChIKey | XVLMUSNNAPQPNF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|