C19H25F3N4OS — CID 111862254
1-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111862254) has the molecular formula C19H25F3N4OS and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111862254 |
| Molecular Formula | C19H25F3N4OS |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | FC(F)(F)CN1CCC(N/C(=N/CCc2cccs2)NCCc2ccco2)C1 |
| InChI | InChI=1S/C19H25F3N4OS/c20-19(21,22)14-26-10-7-15(13-26)25-18(23-8-5-16-3-1-11-27-16)24-9-6-17-4-2-12-28-17/h1-4,11-12,15H,5-10,13-14H2,(H2,23,24,25) |
| InChIKey | UWSPGSDGFRQXQB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|