C12H15BrO5 — CID 11186231
9-bromo-6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one (PubChem CID 11186231) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is 9-bromo-6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one.
| Compound Name | 9-bromo-6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
|---|---|
| PubChem CID | 11186231 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 9-bromo-6,6-dimethoxy-3,3-dimethyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
| SMILES | COC1(OC)C=CC(Br)=CC12OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C12H15BrO5/c1-10(2)9(14)17-12(18-10)7-8(13)5-6-11(12,15-3)16-4/h5-7H,1-4H3 |
| InChIKey | GZIDTGWQJNNHOR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|