C25H37IN4O3 — CID 111862389
1-[2-(furan-2-yl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111862389) has the molecular formula C25H37IN4O3 and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111862389 |
| Molecular Formula | C25H37IN4O3 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CCC(CC/N=C(\NCCc1ccco1)Nc1ccc(OC(C)C)cc1)N1CCCC1=O.I |
| InChI | InChI=1S/C25H36N4O3.HI/c1-4-21(29-17-5-8-24(29)30)13-15-26-25(27-16-14-22-7-6-18-31-22)28-20-9-11-23(12-10-20)32-19(2)3;/h6-7,9-12,18-19,21H,4-5,8,13-17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | ACYLMSAHSSRTKR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|