C15H16FN3O4 — CID 11186310
7-(3-aminopyrrolidin-1-yl)-6-fluoro-5-methoxy-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 11186310) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-6-fluoro-5-methoxy-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-5-methoxy-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11186310 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-5-methoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | COc1c(F)c(N2CCC(N)C2)cc2[nH]cc(C(=O)O)c(=O)c12 |
| InChI | InChI=1S/C15H16FN3O4/c1-23-14-11-9(18-5-8(13(11)20)15(21)22)4-10(12(14)16)19-3-2-7(17)6-19/h4-5,7H,2-3,6,17H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | RRLBLOKFLVZKMC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |