C25H29IN6O — CID 111863743
2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863743) has the molecular formula C25H29IN6O and a molecular weight of 556.45 g/mol. Its IUPAC name is 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863743 |
| Molecular Formula | C25H29IN6O |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 2-methyl-1-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(-n2cccn2)cc1)NCCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C25H28N6O.HI/c1-19-4-8-21(9-5-19)24-30-22(18-32-24)13-16-28-25(26-2)27-15-12-20-6-10-23(11-7-20)31-17-3-14-29-31;/h3-11,14,17-18H,12-13,15-16H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | NGWOTNYABIPTJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|