C15H21N3OS2 — CID 11186376
4-(1H-imidazol-5-ylmethoxy)-1-[(5-methylsulfanylthiophen-2-yl)methyl]piperidine (PubChem CID 11186376) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylmethoxy)-1-[(5-methylsulfanylthiophen-2-yl)methyl]piperidine.
| Compound Name | 4-(1H-imidazol-5-ylmethoxy)-1-[(5-methylsulfanylthiophen-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 11186376 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-(1H-imidazol-5-ylmethoxy)-1-[(5-methylsulfanylthiophen-2-yl)methyl]piperidine |
| SMILES | CSc1ccc(CN2CCC(OCc3cnc[nH]3)CC2)s1 |
| InChI | InChI=1S/C15H21N3OS2/c1-20-15-3-2-14(21-15)9-18-6-4-13(5-7-18)19-10-12-8-16-11-17-12/h2-3,8,11,13H,4-7,9-10H2,1H3,(H,16,17) |
| InChIKey | SOYBWXLQJMCRAQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |