About 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine
5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 11186440) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
Analyze 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (CID 11186440) is 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine is CN1CCc2ncsc2C1.
What is the InChIKey of 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is JSYKQYFGEPJWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-9-3-2-6-7(4-9)10-5-8-6/h5H,2-4H2,1H3.
What are the key properties of 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 154.24 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 11186440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).