About tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate
tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 11186472) has the molecular formula C15H25N3O3S
and a molecular weight of 327.45 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 11186472 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)sc1C(=O)NC(C)C(C)C |
| InChI | InChI=1S/C15H25N3O3S/c1-8(2)9(3)16-12(19)11-10(4)17-13(22-11)18-14(20)21-15(5,6)7/h8-9H,1-7H3,(H,16,19)(H,17,18,20) |
| InChIKey | VIJXCAHIZOBABG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate (CID 11186472) is tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate is Cc1nc(NC(=O)OC(C)(C)C)sc1C(=O)NC(C)C(C)C.
What is the InChIKey of tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate?
The InChIKey is VIJXCAHIZOBABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O3S/c1-8(2)9(3)16-12(19)11-10(4)17-13(22-11)18-14(20)21-15(5,6)7/h8-9H,1-7H3,(H,16,19)(H,17,18,20).
What are the key properties of tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate has a molecular weight of 327.45 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-methyl-5-(3-methylbutan-2-ylcarbamoyl)-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 11186472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).