C15H21ClN2O4 — CID 11186504
2-[(3-chlorophenyl)carbamoylamino]ethyl pentyl carbonate (PubChem CID 11186504) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]ethyl pentyl carbonate.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]ethyl pentyl carbonate |
|---|---|
| PubChem CID | 11186504 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]ethyl pentyl carbonate |
| SMILES | CCCCCOC(=O)OCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O4/c1-2-3-4-9-21-15(20)22-10-8-17-14(19)18-13-7-5-6-12(16)11-13/h5-7,11H,2-4,8-10H2,1H3,(H2,17,18,19) |
| InChIKey | HUCSCNWGTSWSGS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|