C16H17ClN6 — CID 11186505
N-(2-chloro-6-methylphenyl)-3,12-dimethyl-1,3,5,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine (PubChem CID 11186505) has the molecular formula C16H17ClN6 and a molecular weight of 328.81 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-3,12-dimethyl-1,3,5,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine.
| Compound Name | N-(2-chloro-6-methylphenyl)-3,12-dimethyl-1,3,5,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine |
|---|---|
| PubChem CID | 11186505 |
| Molecular Formula | C16H17ClN6 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-3,12-dimethyl-1,3,5,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine |
| SMILES | Cc1cccc(Cl)c1NC1=NC2N=CN(C)C2n2c1cnc2C |
| InChI | InChI=1S/C16H17ClN6/c1-9-5-4-6-11(17)13(9)20-14-12-7-18-10(2)23(12)16-15(21-14)19-8-22(16)3/h4-8,15-16H,1-3H3,(H,20,21) |
| InChIKey | MGNJVRUCYMNJIU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |