C18H30F2N4O — CID 111865384
1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[[2-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine (PubChem CID 111865384) has the molecular formula C18H30F2N4O and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[[2-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[[2-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111865384 |
| Molecular Formula | C18H30F2N4O |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[[2-(difluoromethoxy)phenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCCN(C)C(C)CC |
| InChI | InChI=1S/C18H30F2N4O/c1-5-14(3)24(4)12-11-22-18(21-6-2)23-13-15-9-7-8-10-16(15)25-17(19)20/h7-10,14,17H,5-6,11-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | UCXLTOYHYKIUCM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|