C15H26O6Si — CID 11186560
methyl (2S,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 11186560) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is methyl (2S,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 11186560 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | methyl (2S,3R,4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H26O6Si/c1-10(16)20-12-11(21-22(6,7)15(2,3)4)8-9-19-13(12)14(17)18-5/h8-9,11-13H,1-7H3/t11-,12+,13+/m1/s1 |
| InChIKey | HVVSTKVEXRXBGY-AGIUHOORSA-N |
| XLogP | 2.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|