About 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline
5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline (PubChem CID 11186635) has the molecular formula C18H20FNO4
and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline |
| PubChem CID | 11186635 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline |
| SMILES | COc1ccc(/C=C(/F)c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C18H20FNO4/c1-21-15-6-5-11(8-14(15)20)7-13(19)12-9-16(22-2)18(24-4)17(10-12)23-3/h5-10H,20H2,1-4H3/b13-7+ |
| InChIKey | ZUMOXDRSPFSJNV-NTUHNPAUSA-N |
| XLogP | 3.77 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline?
The IUPAC name of 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline (CID 11186635) is 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline.
What is the SMILES notation for 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline?
The canonical SMILES for 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline is COc1ccc(/C=C(/F)c2cc(OC)c(OC)c(OC)c2)cc1N.
What is the InChIKey of 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline?
The InChIKey is ZUMOXDRSPFSJNV-NTUHNPAUSA-N. The full InChI is InChI=1S/C18H20FNO4/c1-21-15-6-5-11(8-14(15)20)7-13(19)12-9-16(22-2)18(24-4)17(10-12)23-3/h5-10H,20H2,1-4H3/b13-7+.
What are the key properties of 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline?
5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline has a molecular weight of 333.36 g/mol, XLogP of 3.77, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-fluoro-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyaniline is sourced from PubChem (CID 11186635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).