About (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one
(4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11186706) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| PubChem CID | 11186706 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(/C(=C\N1C(=O)OC[C@H]1C(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-16(2)21-15-25-22(24)23(21)14-20(19-12-8-5-9-13-19)17(3)18-10-6-4-7-11-18/h4-14,16-17,21H,15H2,1-3H3/b20-14+/t17?,21-/m0/s1 |
| InChIKey | ZLJBSEQHHRSVAH-IXRQFEILSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The IUPAC name of (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one (CID 11186706) is (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one is CC(/C(=C\N1C(=O)OC[C@H]1C(C)C)c1ccccc1)c1ccccc1.
What is the InChIKey of (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The InChIKey is ZLJBSEQHHRSVAH-IXRQFEILSA-N. The full InChI is InChI=1S/C22H25NO2/c1-16(2)21-15-25-22(24)23(21)14-20(19-12-8-5-9-13-19)17(3)18-10-6-4-7-11-18/h4-14,16-17,21H,15H2,1-3H3/b20-14+/t17?,21-/m0/s1.
What are the key properties of (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
(4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one has a molecular weight of 335.45 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-[(E)-2,3-diphenylbut-1-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 11186706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).