C17H23NO6 — CID 11186758
1-O-tert-butyl 5-O,6-O-dimethyl 4,5,6,7-tetrahydro-2H-isoindole-1,5,6-tricarboxylate (PubChem CID 11186758) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O,6-O-dimethyl 4,5,6,7-tetrahydro-2H-isoindole-1,5,6-tricarboxylate.
| Compound Name | 1-O-tert-butyl 5-O,6-O-dimethyl 4,5,6,7-tetrahydro-2H-isoindole-1,5,6-tricarboxylate |
|---|---|
| PubChem CID | 11186758 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-O-tert-butyl 5-O,6-O-dimethyl 4,5,6,7-tetrahydro-2H-isoindole-1,5,6-tricarboxylate |
| SMILES | COC(=O)C1Cc2c[nH]c(C(=O)OC(C)(C)C)c2CC1C(=O)OC |
| InChI | InChI=1S/C17H23NO6/c1-17(2,3)24-16(21)13-10-7-12(15(20)23-5)11(14(19)22-4)6-9(10)8-18-13/h8,11-12,18H,6-7H2,1-5H3 |
| InChIKey | UFPXAWLUUWMFAE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|