C14H26O7S — CID 11186791
tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 11186791) has the molecular formula C14H26O7S and a molecular weight of 338.42 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11186791 |
| Molecular Formula | C14H26O7S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](COS(C)(=O)=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H26O7S/c1-13(2,3)21-12(15)8-10-7-11(9-18-22(6,16)17)20-14(4,5)19-10/h10-11H,7-9H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | IQVAFMFHDJRRRS-MNOVXSKESA-N |
| XLogP | 1.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|