About diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate
diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate (PubChem CID 11186814) has the molecular formula C13H16Cl2O6
and a molecular weight of 339.17 g/mol. Its IUPAC name is diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate.
Molecular Properties
| Compound Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate |
| PubChem CID | 11186814 |
| Molecular Formula | C13H16Cl2O6 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(C(=O)OCC)C1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C13H16Cl2O6/c1-4-13(11(17)19-5-2,12(18)20-6-3)9-7(14)8(15)10(16)21-9/h9H,4-6H2,1-3H3 |
| InChIKey | GBAYMWSKHKNLRR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate?
The IUPAC name of diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate (CID 11186814) is diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate.
What is the SMILES notation for diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate?
The canonical SMILES for diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate is CCOC(=O)C(CC)(C(=O)OCC)C1OC(=O)C(Cl)=C1Cl.
What is the InChIKey of diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate?
The InChIKey is GBAYMWSKHKNLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2O6/c1-4-13(11(17)19-5-2,12(18)20-6-3)9-7(14)8(15)10(16)21-9/h9H,4-6H2,1-3H3.
What are the key properties of diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate?
diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate has a molecular weight of 339.17 g/mol, XLogP of 2.12, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-ethylpropanedioate is sourced from PubChem (CID 11186814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).