C18H26FNO4 — CID 11186829
Edivoxetine (PubChem CID 11186829) has the molecular formula C18H26FNO4 and a molecular weight of 339.40 g/mol. Its IUPAC name is (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol.
| Compound Name | Edivoxetine |
|---|---|
| PubChem CID | 11186829 |
| Molecular Formula | C18H26FNO4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol |
| SMILES | COC1=C(C=C(C=C1)F)C[C@]([C@@H]2CNCCO2)(C3CCOCC3)O |
| InChI | InChI=1S/C18H26FNO4/c1-22-16-3-2-15(19)10-13(16)11-18(21,14-4-7-23-8-5-14)17-12-20-6-9-24-17/h2-3,10,14,17,20-21H,4-9,11-12H2,1H3/t17-,18+/m0/s1 |
| InChIKey | CPBHSHYQQLFAPW-ZWKOTPCHSA-N |
| XLogP | 1.30 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 393 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |