C12H12F8O2 — CID 11186843
2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 11186843) has the molecular formula C12H12F8O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11186843 |
| Molecular Formula | C12H12F8O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C1(F)C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H12F8O2/c1-5(2)6(21)22-8(3,4)9(14)7(13)10(15,16)12(19,20)11(9,17)18/h7H,1H2,2-4H3 |
| InChIKey | SNBVXDYOEOCYKM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|