About 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol
1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol (PubChem CID 11186974) has the molecular formula C22H30FNO
and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol |
| PubChem CID | 11186974 |
| Molecular Formula | C22H30FNO |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol |
| SMILES | CCCc1c(C(C)C)nc(C(C)C)c(C(C)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H30FNO/c1-7-8-18-20(16-9-11-17(23)12-10-16)19(15(6)25)22(14(4)5)24-21(18)13(2)3/h9-15,25H,7-8H2,1-6H3 |
| InChIKey | XPINZAYSUKBJNK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol?
The IUPAC name of 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol (CID 11186974) is 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol.
What is the SMILES notation for 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol?
The canonical SMILES for 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol is CCCc1c(C(C)C)nc(C(C)C)c(C(C)O)c1-c1ccc(F)cc1.
What is the InChIKey of 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol?
The InChIKey is XPINZAYSUKBJNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30FNO/c1-7-8-18-20(16-9-11-17(23)12-10-16)19(15(6)25)22(14(4)5)24-21(18)13(2)3/h9-15,25H,7-8H2,1-6H3.
What are the key properties of 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol?
1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol has a molecular weight of 343.49 g/mol, XLogP of 6.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)-5-propyl-3-pyridinyl]ethanol is sourced from PubChem (CID 11186974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).