C20H23FO4 — CID 11187072
dimethyl (1R,2R,3S)-3-[1-(4-fluorophenyl)-2-methylprop-1-enyl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 11187072) has the molecular formula C20H23FO4 and a molecular weight of 346.40 g/mol. Its IUPAC name is dimethyl (1R,2R,3S)-3-[1-(4-fluorophenyl)-2-methylprop-1-enyl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S)-3-[1-(4-fluorophenyl)-2-methylprop-1-enyl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11187072 |
| Molecular Formula | C20H23FO4 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | dimethyl (1R,2R,3S)-3-[1-(4-fluorophenyl)-2-methylprop-1-enyl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=C(C)C)c2ccc(F)cc2)C=CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C20H23FO4/c1-12(2)17(13-8-10-14(21)11-9-13)15-6-5-7-16(19(22)24-3)18(15)20(23)25-4/h5-6,8-11,15-16,18H,7H2,1-4H3/t15-,16-,18-/m1/s1 |
| InChIKey | LWYPZXAGGIYBQB-JFIYKMOQSA-N |
| XLogP | 3.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|