C21H31F3N4O2 — CID 111870857
2-cyclohexyl-N-[2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide (PubChem CID 111870857) has the molecular formula C21H31F3N4O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111870857 |
| Molecular Formula | C21H31F3N4O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
| SMILES | C/N=C(\NCCNC(=O)CC1CCCCC1)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H31F3N4O2/c1-25-20(27-12-11-26-19(29)13-16-5-3-2-4-6-16)28-14-17-7-9-18(10-8-17)30-15-21(22,23)24/h7-10,16H,2-6,11-15H2,1H3,(H,26,29)(H2,25,27,28) |
| InChIKey | MDZNUAGAXAQFAH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|