About (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide
(E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide (PubChem CID 11187118) has the molecular formula C21H18ClN3
and a molecular weight of 347.85 g/mol. Its IUPAC name is (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide |
| PubChem CID | 11187118 |
| Molecular Formula | C21H18ClN3 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide |
| SMILES | NC(/C=C/c1ccc(Cc2ccncc2)cc1)=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClN3/c22-19-6-8-20(9-7-19)25-21(23)10-5-16-1-3-17(4-2-16)15-18-11-13-24-14-12-18/h1-14H,15H2,(H2,23,25)/b10-5+ |
| InChIKey | OVYDCGQQYOVLCO-BJMVGYQFSA-N |
| XLogP | 5.03 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide?
The IUPAC name of (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide (CID 11187118) is (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide.
What is the SMILES notation for (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide?
The canonical SMILES for (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide is NC(/C=C/c1ccc(Cc2ccncc2)cc1)=N\c1ccc(Cl)cc1.
What is the InChIKey of (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide?
The InChIKey is OVYDCGQQYOVLCO-BJMVGYQFSA-N. The full InChI is InChI=1S/C21H18ClN3/c22-19-6-8-20(9-7-19)25-21(23)10-5-16-1-3-17(4-2-16)15-18-11-13-24-14-12-18/h1-14H,15H2,(H2,23,25)/b10-5+.
What are the key properties of (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide?
(E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide has a molecular weight of 347.85 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(4-chlorophenyl)-3-[4-(pyridin-4-ylmethyl)phenyl]prop-2-enimidamide is sourced from PubChem (CID 11187118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).