C20H25F3IN5O2 — CID 111871256
N-(6-methyl-2-pyridinyl)-3-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111871256) has the molecular formula C20H25F3IN5O2 and a molecular weight of 551.35 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-3-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(6-methyl-2-pyridinyl)-3-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111871256 |
| Molecular Formula | C20H25F3IN5O2 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-3-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)Nc1cccc(C)n1)NCc1ccc(OCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H24F3N5O2.HI/c1-14-4-3-5-17(27-14)28-18(29)10-11-25-19(24-2)26-12-15-6-8-16(9-7-15)30-13-20(21,22)23;/h3-9H,10-13H2,1-2H3,(H2,24,25,26)(H,27,28,29);1H |
| InChIKey | LKZWIFYGSFRHQX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|