C20H25F3IN3O3 — CID 111871588
1-[2-(3-methoxyphenoxy)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871588) has the molecular formula C20H25F3IN3O3 and a molecular weight of 539.34 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenoxy)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-methoxyphenoxy)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871588 |
| Molecular Formula | C20H25F3IN3O3 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 1-[2-(3-methoxyphenoxy)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1cccc(OC)c1)NCc1ccc(OCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H24F3N3O3.HI/c1-24-19(25-10-11-28-18-5-3-4-17(12-18)27-2)26-13-15-6-8-16(9-7-15)29-14-20(21,22)23;/h3-9,12H,10-11,13-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | NNXANDXBUXHHBQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|