C21H23F3IN5O — CID 111871682
2-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871682) has the molecular formula C21H23F3IN5O and a molecular weight of 545.35 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871682 |
| Molecular Formula | C21H23F3IN5O |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 2-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)cc1)NCc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C21H22F3N5O.HI/c1-25-20(26-11-16-7-9-19(10-8-16)30-15-21(22,23)24)27-12-17-13-28-29(14-17)18-5-3-2-4-6-18;/h2-10,13-14H,11-12,15H2,1H3,(H2,25,26,27);1H |
| InChIKey | FLHRGKUYQKFXHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|