C21H20F2N4O — CID 111875939
1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111875939) has the molecular formula C21H20F2N4O and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111875939 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[(3-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(Oc2cccc(F)c2)nc1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C21H20F2N4O/c1-24-21(26-12-15-4-2-5-17(22)10-15)27-14-16-8-9-20(25-13-16)28-19-7-3-6-18(23)11-19/h2-11,13H,12,14H2,1H3,(H2,24,26,27) |
| InChIKey | JIGMQHHSCWVTHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|