About (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol
(Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol (PubChem CID 11187760) has the molecular formula C15H14OSe2
and a molecular weight of 368.20 g/mol. Its IUPAC name is (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol |
| PubChem CID | 11187760 |
| Molecular Formula | C15H14OSe2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol |
| SMILES | OC/C(=C/[Se]c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C15H14OSe2/c16-11-15(18-14-9-5-2-6-10-14)12-17-13-7-3-1-4-8-13/h1-10,12,16H,11H2/b15-12- |
| InChIKey | BRDKEVQPQBBTER-QINSGFPZSA-N |
| XLogP | 0.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol?
The IUPAC name of (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol (CID 11187760) is (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol.
What is the SMILES notation for (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol?
The canonical SMILES for (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol is OC/C(=C/[Se]c1ccccc1)[Se]c1ccccc1.
What is the InChIKey of (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol?
The InChIKey is BRDKEVQPQBBTER-QINSGFPZSA-N. The full InChI is InChI=1S/C15H14OSe2/c16-11-15(18-14-9-5-2-6-10-14)12-17-13-7-3-1-4-8-13/h1-10,12,16H,11H2/b15-12-.
What are the key properties of (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol?
(Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol has a molecular weight of 368.20 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-bis(phenylselanyl)prop-2-en-1-ol is sourced from PubChem (CID 11187760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).