C19H26F2N2O3 — CID 11187769
(E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]pent-3-enamide (PubChem CID 11187769) has the molecular formula C19H26F2N2O3 and a molecular weight of 368.42 g/mol. Its IUPAC name is (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]pent-3-enamide.
| Compound Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]pent-3-enamide |
|---|---|
| PubChem CID | 11187769 |
| Molecular Formula | C19H26F2N2O3 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]pent-3-enamide |
| SMILES | C/C=C/CC(=O)NC(C)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C19H26F2N2O3/c1-4-5-6-19(26)22-12(2)7-18(25)17(23-13(3)24)10-14-8-15(20)11-16(21)9-14/h4-5,8-9,11-12,17-18,25H,6-7,10H2,1-3H3,(H,22,26)(H,23,24)/b5-4+/t12?,17-,18-/m0/s1 |
| InChIKey | FSGRDSIVUGGCKL-IMVBXCRWSA-N |
| XLogP | 2.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|