C16H22FN5 — CID 111877809
1-ethyl-2-[(3-fluorophenyl)methyl]-3-(3-imidazol-1-ylpropyl)guanidine (PubChem CID 111877809) has the molecular formula C16H22FN5 and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluorophenyl)methyl]-3-(3-imidazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-(3-imidazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111877809 |
| Molecular Formula | C16H22FN5 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-(3-imidazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCCn1ccnc1 |
| InChI | InChI=1S/C16H22FN5/c1-2-19-16(20-7-4-9-22-10-8-18-13-22)21-12-14-5-3-6-15(17)11-14/h3,5-6,8,10-11,13H,2,4,7,9,12H2,1H3,(H2,19,20,21) |
| InChIKey | QCGSWKFVANPEMC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|