C18H36O2Si3 — CID 11187788
trimethyl-[(E)-3-[3-trimethylsilyl-1-[(E)-3-trimethylsilylprop-2-enoxy]prop-2-ynoxy]prop-1-enyl]silane (PubChem CID 11187788) has the molecular formula C18H36O2Si3 and a molecular weight of 368.74 g/mol. Its IUPAC name is trimethyl-[(E)-3-[3-trimethylsilyl-1-[(E)-3-trimethylsilylprop-2-enoxy]prop-2-ynoxy]prop-1-enyl]silane.
| Compound Name | trimethyl-[(E)-3-[3-trimethylsilyl-1-[(E)-3-trimethylsilylprop-2-enoxy]prop-2-ynoxy]prop-1-enyl]silane |
|---|---|
| PubChem CID | 11187788 |
| Molecular Formula | C18H36O2Si3 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | trimethyl-[(E)-3-[3-trimethylsilyl-1-[(E)-3-trimethylsilylprop-2-enoxy]prop-2-ynoxy]prop-1-enyl]silane |
| SMILES | C[Si](C)(C)C#CC(OC/C=C/[Si](C)(C)C)OC/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C18H36O2Si3/c1-21(2,3)15-10-13-19-18(12-17-23(7,8)9)20-14-11-16-22(4,5)6/h10-11,15-16,18H,13-14H2,1-9H3/b15-10+,16-11+ |
| InChIKey | YGYSUZGGWTUAAO-RWPWKDLBSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|