C24H19NO3 — CID 11187806
(3S,5S)-3-phenyl-5-(1H-pyrrol-2-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 11187806) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is (3S,5S)-3-phenyl-5-(1H-pyrrol-2-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | (3S,5S)-3-phenyl-5-(1H-pyrrol-2-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 11187806 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (3S,5S)-3-phenyl-5-(1H-pyrrol-2-yl)spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | O=C1C[C@H](c2ccc[nH]2)C2(C(=O)c3ccccc3C2=O)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H19NO3/c26-16-13-19(15-7-2-1-3-8-15)24(20(14-16)21-11-6-12-25-21)22(27)17-9-4-5-10-18(17)23(24)28/h1-12,19-20,25H,13-14H2/t19-,20+/m0/s1 |
| InChIKey | UGWBTWORQFBDOG-VQTJNVASSA-N |
| XLogP | 4.31 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|