C21H32F3NO — CID 11187880
N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoro-N-non-1-en-4-ylacetamide (PubChem CID 11187880) has the molecular formula C21H32F3NO and a molecular weight of 371.49 g/mol. Its IUPAC name is N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoro-N-non-1-en-4-ylacetamide.
| Compound Name | N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoro-N-non-1-en-4-ylacetamide |
|---|---|
| PubChem CID | 11187880 |
| Molecular Formula | C21H32F3NO |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoro-N-non-1-en-4-ylacetamide |
| SMILES | C=CCCCC(C=C)(C=C)N(C(=O)C(F)(F)F)C(CC=C)CCCCC |
| InChI | InChI=1S/C21H32F3NO/c1-6-11-13-16-18(15-8-3)25(19(26)21(22,23)24)20(9-4,10-5)17-14-12-7-2/h7-10,18H,2-6,11-17H2,1H3 |
| InChIKey | ALQLNCAXOSMSNA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|