C19H34N4O2 — CID 111879249
1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)-4-methylpentyl]-2-methylguanidine (PubChem CID 111879249) has the molecular formula C19H34N4O2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)-4-methylpentyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)-4-methylpentyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111879249 |
| Molecular Formula | C19H34N4O2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)-4-methylpentyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(OC)cc1OC)NCC(CC(C)C)N(C)C |
| InChI | InChI=1S/C19H34N4O2/c1-14(2)10-16(23(4)5)13-22-19(20-3)21-12-15-8-9-17(24-6)11-18(15)25-7/h8-9,11,14,16H,10,12-13H2,1-7H3,(H2,20,21,22) |
| InChIKey | XJIOHKRFMNGAMI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|