C20H26O3S2 — CID 11188121
(2S)-1,1-bis[(S)-(4-methylphenyl)sulfinyl]hexan-2-ol (PubChem CID 11188121) has the molecular formula C20H26O3S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (2S)-1,1-bis[(S)-(4-methylphenyl)sulfinyl]hexan-2-ol.
| Compound Name | (2S)-1,1-bis[(S)-(4-methylphenyl)sulfinyl]hexan-2-ol |
|---|---|
| PubChem CID | 11188121 |
| Molecular Formula | C20H26O3S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2S)-1,1-bis[(S)-(4-methylphenyl)sulfinyl]hexan-2-ol |
| SMILES | CCCC[C@H](O)C([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26O3S2/c1-4-5-6-19(21)20(24(22)17-11-7-15(2)8-12-17)25(23)18-13-9-16(3)10-14-18/h7-14,19-21H,4-6H2,1-3H3/t19-,24-,25-/m0/s1 |
| InChIKey | DAHYLQVZJPULAU-LQGLAIQGSA-N |
| XLogP | 4.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |