C25H36N4O2 — CID 111881223
1-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-3-[(2-ethoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111881223) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-3-[(2-ethoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-3-[(2-ethoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111881223 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-3-[(2-ethoxyphenyl)methyl]-2-methylguanidine |
| SMILES | CCOc1ccccc1CN/C(=N\C)NCc1ccc(CN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C25H36N4O2/c1-5-30-24-9-7-6-8-23(24)15-28-25(26-4)27-14-21-10-12-22(13-11-21)18-29-16-19(2)31-20(3)17-29/h6-13,19-20H,5,14-18H2,1-4H3,(H2,26,27,28) |
| InChIKey | NXBJIWPLVYWECK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|