C19H24FNO4S — CID 11188201
(1R,2S,3R,5R,6R)-2-amino-3-[(4-tert-butylphenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11188201) has the molecular formula C19H24FNO4S and a molecular weight of 381.47 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-3-[(4-tert-butylphenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-3-[(4-tert-butylphenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11188201 |
| Molecular Formula | C19H24FNO4S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-3-[(4-tert-butylphenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CC(C)(C)c1ccc(CS[C@@H]2C[C@@H]3[C@H]([C@]2(N)C(=O)O)[C@@]3(F)C(=O)O)cc1 |
| InChI | InChI=1S/C19H24FNO4S/c1-17(2,3)11-6-4-10(5-7-11)9-26-13-8-12-14(18(12,20)15(22)23)19(13,21)16(24)25/h4-7,12-14H,8-9,21H2,1-3H3,(H,22,23)(H,24,25)/t12-,13-,14+,18-,19+/m1/s1 |
| InChIKey | WAXVJANMVDSRSK-GOSIZQOLSA-N |
| XLogP | 2.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |