About [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene
[[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene (PubChem CID 11188262) has the molecular formula C26H25NO2
and a molecular weight of 383.49 g/mol. Its IUPAC name is [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene.
Molecular Properties
| Compound Name | [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene |
| PubChem CID | 11188262 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene |
| SMILES | C/C=C/[C@](C)(COC(c1ccccc1)(c1ccccc1)c1ccccc1)N=C=O |
| InChI | InChI=1S/C26H25NO2/c1-3-19-25(2,27-21-28)20-29-26(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h3-19H,20H2,1-2H3/b19-3+/t25-/m1/s1 |
| InChIKey | LSFUQFAMANRFCP-RDLYDHCBSA-N |
| XLogP | 5.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene?
The IUPAC name of [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene (CID 11188262) is [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene.
What is the SMILES notation for [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene?
The canonical SMILES for [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene is C/C=C/[C@](C)(COC(c1ccccc1)(c1ccccc1)c1ccccc1)N=C=O.
What is the InChIKey of [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene?
The InChIKey is LSFUQFAMANRFCP-RDLYDHCBSA-N. The full InChI is InChI=1S/C26H25NO2/c1-3-19-25(2,27-21-28)20-29-26(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h3-19H,20H2,1-2H3/b19-3+/t25-/m1/s1.
What are the key properties of [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene?
[[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene has a molecular weight of 383.49 g/mol, XLogP of 5.67, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(E,2R)-2-isocyanato-2-methylpent-3-enoxy]-diphenylmethyl]benzene is sourced from PubChem (CID 11188262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).