C22H24O6 — CID 11188279
dimethyl 8,8-dimethyl-6,10-dioxo-2-phenylspiro[4.5]dec-2-ene-3,4-dicarboxylate (PubChem CID 11188279) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is dimethyl 8,8-dimethyl-6,10-dioxo-2-phenylspiro[4.5]dec-2-ene-3,4-dicarboxylate.
| Compound Name | dimethyl 8,8-dimethyl-6,10-dioxo-2-phenylspiro[4.5]dec-2-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11188279 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | dimethyl 8,8-dimethyl-6,10-dioxo-2-phenylspiro[4.5]dec-2-ene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)CC2(C(=O)CC(C)(C)CC2=O)C1C(=O)OC |
| InChI | InChI=1S/C22H24O6/c1-21(2)11-15(23)22(16(24)12-21)10-14(13-8-6-5-7-9-13)17(19(25)27-3)18(22)20(26)28-4/h5-9,18H,10-12H2,1-4H3 |
| InChIKey | QIBJUYZODHRKPH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|