C19H23ClN4O — CID 111883189
3-[[[[2-(2-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 111883189) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 3-[[[[2-(2-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[[2-(2-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111883189 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[[[[2-(2-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C19H23ClN4O/c1-2-22-19(23-11-10-15-7-3-4-9-17(15)20)24-13-14-6-5-8-16(12-14)18(21)25/h3-9,12H,2,10-11,13H2,1H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | LEMJWZGXYDJVRA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|