C21H36N6O3 — CID 111883881
tert-butyl N-[2-[[N-[[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111883881) has the molecular formula C21H36N6O3 and a molecular weight of 420.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111883881 |
| Molecular Formula | C21H36N6O3 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | tert-butyl N-[2-[[N-[[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1cccc(C(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C21H36N6O3/c1-21(2,3)30-20(29)25-11-10-24-19(22-4)26-15-16-8-7-9-17(14-16)18(28)23-12-13-27(5)6/h7-9,14H,10-13,15H2,1-6H3,(H,23,28)(H,25,29)(H2,22,24,26) |
| InChIKey | XKJPPVZFWCELFX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|