C22H34N2O4 — CID 11188458
2,2-dimethylbutyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 11188458) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2,2-dimethylbutyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | 2,2-dimethylbutyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 11188458 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2,2-dimethylbutyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCC(C)(C)CC)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H34N2O4/c1-6-8-14-18(24-21(27)28-15-22(4,5)7-2)19(25)20(26)23-16(3)17-12-10-9-11-13-17/h9-13,16,18H,6-8,14-15H2,1-5H3,(H,23,26)(H,24,27)/t16-,18+/m1/s1 |
| InChIKey | YBAFPPBBTCNFMR-AEFFLSMTSA-N |
| XLogP | 4.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|