C18H15BrFNO3 — CID 11188503
10-(3-bromo-4-fluorophenyl)-4,5,6,7,8,10-hexahydro-3H-pyrano[4,3-b]quinoline-1,9-dione (PubChem CID 11188503) has the molecular formula C18H15BrFNO3 and a molecular weight of 392.22 g/mol. Its IUPAC name is 10-(3-bromo-4-fluorophenyl)-4,5,6,7,8,10-hexahydro-3H-pyrano[4,3-b]quinoline-1,9-dione.
| Compound Name | 10-(3-bromo-4-fluorophenyl)-4,5,6,7,8,10-hexahydro-3H-pyrano[4,3-b]quinoline-1,9-dione |
|---|---|
| PubChem CID | 11188503 |
| Molecular Formula | C18H15BrFNO3 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 10-(3-bromo-4-fluorophenyl)-4,5,6,7,8,10-hexahydro-3H-pyrano[4,3-b]quinoline-1,9-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(F)c(Br)c1)C1=C(CCOC1=O)N2 |
| InChI | InChI=1S/C18H15BrFNO3/c19-10-8-9(4-5-11(10)20)15-16-12(2-1-3-14(16)22)21-13-6-7-24-18(23)17(13)15/h4-5,8,15,21H,1-3,6-7H2 |
| InChIKey | MNBXZLFFMNRTAI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |