C18H37N5O3 — CID 111887489
tert-butyl N-[3-[[N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887489) has the molecular formula C18H37N5O3 and a molecular weight of 371.53 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887489 |
| Molecular Formula | C18H37N5O3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | tert-butyl N-[3-[[N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC1CCCN1CCOC |
| InChI | InChI=1S/C18H37N5O3/c1-18(2,3)26-17(24)21-10-7-9-20-16(19-4)22-14-15-8-6-11-23(15)12-13-25-5/h15H,6-14H2,1-5H3,(H,21,24)(H2,19,20,22) |
| InChIKey | MYLYHVHWXSTKNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|