C22H35N5O3 — CID 111887607
tert-butyl N-[3-[[N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887607) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887607 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | tert-butyl N-[3-[[N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc2C1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N5O3/c1-5-23-20(24-12-8-13-25-21(29)30-22(2,3)4)26-15-19(28)27-14-11-17-9-6-7-10-18(17)16-27/h6-7,9-10H,5,8,11-16H2,1-4H3,(H,25,29)(H2,23,24,26) |
| InChIKey | VPZCHXLOUDTQKI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|