C22H20ClN5O — CID 11188944
1-(4-chlorophenyl)-2-(3-phenylmethoxyphenyl)-2H-1,3,5-triazine-4,6-diamine (PubChem CID 11188944) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-phenylmethoxyphenyl)-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-(4-chlorophenyl)-2-(3-phenylmethoxyphenyl)-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 11188944 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-phenylmethoxyphenyl)-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NC(c2cccc(OCc3ccccc3)c2)N(c2ccc(Cl)cc2)C(N)=N1 |
| InChI | InChI=1S/C22H20ClN5O/c23-17-9-11-18(12-10-17)28-20(26-21(24)27-22(28)25)16-7-4-8-19(13-16)29-14-15-5-2-1-3-6-15/h1-13,20H,14H2,(H4,24,25,26,27) |
| InChIKey | POJCBBWXTMJTRM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |