C24H40O5 — CID 11189028
(2S)-2-[(3R,6R)-6-[(E)-4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl]-6-methyldioxan-3-yl]propanoic acid (PubChem CID 11189028) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (2S)-2-[(3R,6R)-6-[(E)-4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl]-6-methyldioxan-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(3R,6R)-6-[(E)-4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl]-6-methyldioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11189028 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (2S)-2-[(3R,6R)-6-[(E)-4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enyl]-6-methyldioxan-3-yl]propanoic acid |
| SMILES | CC1=C(CCC(C)(O)/C=C/C[C@@]2(C)CC[C@H]([C@H](C)C(=O)O)OO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H40O5/c1-17-9-7-12-22(3,4)19(17)10-15-23(5,27)13-8-14-24(6)16-11-20(28-29-24)18(2)21(25)26/h8,13,18,20,27H,7,9-12,14-16H2,1-6H3,(H,25,26)/b13-8+/t18-,20+,23?,24-/m0/s1 |
| InChIKey | IOPIOUHRQRYDMU-GGYDGERUSA-N |
| XLogP | 5.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|